C46H52O7SSi — CID 100968232
(2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3,5-dimethoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one (PubChem CID 100968232) has the molecular formula C46H52O7SSi and a molecular weight of 777.07 g/mol. Its IUPAC name is (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3,5-dimethoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one.
| Compound Name | (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3,5-dimethoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 100968232 |
| Molecular Formula | C46H52O7SSi |
| Molecular Weight | 777.07 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3,5-dimethoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one |
| SMILES | COc1cc(CO[C@H]2[C@H](Sc3ccccc3)O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)[C@@H]2O[Si](C)(C)C(C)(C)C)cc(OC)c1 |
| InChI | InChI=1S/C46H52O7SSi/c1-45(2,3)55(6,7)53-42-41(47)40(32-51-46(34-20-12-8-13-21-34,35-22-14-9-15-23-35)36-24-16-10-17-25-36)52-44(54-39-26-18-11-19-27-39)43(42)50-31-33-28-37(48-4)30-38(29-33)49-5/h8-30,40,42-44H,31-32H2,1-7H3/t40-,42+,43-,44+/m1/s1 |
| InChIKey | XTNZZNDEOICTKD-HPSXNYODSA-N |
| XLogP | 10.07 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.07 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|