C32H42O7Si — CID 69329004
(3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolane-2,4-diol (PubChem CID 69329004) has the molecular formula C32H42O7Si and a molecular weight of 566.77 g/mol. Its IUPAC name is (3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolane-2,4-diol.
| Compound Name | (3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolane-2,4-diol |
|---|---|
| PubChem CID | 69329004 |
| Molecular Formula | C32H42O7Si |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | (3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxyoxolane-2,4-diol |
| SMILES | COc1ccc(C(OC[C@H]2OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H42O7Si/c1-31(2,3)40(6,7)39-29-28(33)27(38-30(29)34)21-37-32(22-11-9-8-10-12-22,23-13-17-25(35-4)18-14-23)24-15-19-26(36-5)20-16-24/h8-20,27-30,33-34H,21H2,1-7H3/t27-,28-,29-,30?/m1/s1 |
| InChIKey | KXLGHVREBHXVLD-SLXBMRETSA-N |
| XLogP | 5.48 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|