C45H50N4O7Si — CID 162345886
N-[1-[(3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]imidazo[4,5-c]pyridin-4-yl]benzamide (PubChem CID 162345886) has the molecular formula C45H50N4O7Si and a molecular weight of 787.00 g/mol. Its IUPAC name is N-[1-[(3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]imidazo[4,5-c]pyridin-4-yl]benzamide.
| Compound Name | N-[1-[(3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]imidazo[4,5-c]pyridin-4-yl]benzamide |
|---|---|
| PubChem CID | 162345886 |
| Molecular Formula | C45H50N4O7Si |
| Molecular Weight | 787.00 g/mol |
| Exact Mass | 786.34 |
| IUPAC Name | N-[1-[(3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]imidazo[4,5-c]pyridin-4-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2OC(n3cnc4c(NC(=O)c5ccccc5)nccc43)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H50N4O7Si/c1-44(2,3)57(6,7)56-40-39(50)37(55-43(40)49-29-47-38-36(49)26-27-46-41(38)48-42(51)30-14-10-8-11-15-30)28-54-45(31-16-12-9-13-17-31,32-18-22-34(52-4)23-19-32)33-20-24-35(53-5)25-21-33/h8-27,29,37,39-40,43,50H,28H2,1-7H3,(H,46,48,51)/t37-,39-,40-,43?/m1/s1 |
| InChIKey | CBNDZXNJFHCPAJ-CTNQZOTQSA-N |
| XLogP | 8.36 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.00 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|