C36H43N5O7Si — CID 135466907
7-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-3H-imidazo[4,5-d]triazin-4-one (PubChem CID 135466907) has the molecular formula C36H43N5O7Si and a molecular weight of 685.85 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-3H-imidazo[4,5-d]triazin-4-one.
| Compound Name | 7-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-3H-imidazo[4,5-d]triazin-4-one |
|---|---|
| PubChem CID | 135466907 |
| Molecular Formula | C36H43N5O7Si |
| Molecular Weight | 685.85 g/mol |
| Exact Mass | 685.29 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-3H-imidazo[4,5-d]triazin-4-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]nnc43)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H43N5O7Si/c1-35(2,3)49(6,7)48-31-30(42)28(47-34(31)41-22-37-29-32(41)38-40-39-33(29)43)21-46-36(23-11-9-8-10-12-23,24-13-17-26(44-4)18-14-24)25-15-19-27(45-5)20-16-25/h8-20,22,28,30-31,34,42H,21H2,1-7H3,(H,38,39,43)/t28-,30-,31-,34-/m1/s1 |
| InChIKey | DJXNEIYAPSEJAT-UTBAFCPYSA-N |
| XLogP | 5.19 |
| TPSA | 142.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|