C36H43IN2O8Si — CID 25228521
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 25228521) has the molecular formula C36H43IN2O8Si and a molecular weight of 786.74 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25228521 |
| Molecular Formula | C36H43IN2O8Si |
| Molecular Weight | 786.74 g/mol |
| Exact Mass | 786.18 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(I)c(=O)[nH]c3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H43IN2O8Si/c1-35(2,3)48(6,7)47-31-30(40)29(46-33(31)39-21-28(37)32(41)38-34(39)42)22-45-36(23-11-9-8-10-12-23,24-13-17-26(43-4)18-14-24)25-15-19-27(44-5)20-16-25/h8-21,29-31,33,40H,22H2,1-7H3,(H,38,41,42)/t29-,30-,31-,33-/m1/s1 |
| InChIKey | IRSHGAQJJGFWPT-WTGZKXAYSA-N |
| XLogP | 5.82 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.74 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|