C42H50N2O10Si — CID 154320360
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-6,7-dimethoxyquinazoline-2,4-dione (PubChem CID 154320360) has the molecular formula C42H50N2O10Si and a molecular weight of 770.95 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-6,7-dimethoxyquinazoline-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-6,7-dimethoxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 154320360 |
| Molecular Formula | C42H50N2O10Si |
| Molecular Weight | 770.95 g/mol |
| Exact Mass | 770.32 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyoxolan-2-yl]-6,7-dimethoxyquinazoline-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3c(=O)[nH]c(=O)c4cc(OC)c(OC)cc43)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H50N2O10Si/c1-41(2,3)55(8,9)54-37-36(45)35(53-39(37)44-32-24-34(51-7)33(50-6)23-31(32)38(46)43-40(44)47)25-52-42(26-13-11-10-12-14-26,27-15-19-29(48-4)20-16-27)28-17-21-30(49-5)22-18-28/h10-24,35-37,39,45H,25H2,1-9H3,(H,43,46,47)/t35-,36-,37-,39-/m1/s1 |
| InChIKey | PYOUDANWJZVGTK-QZVXKSRUSA-N |
| XLogP | 6.38 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.95 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|