C36H44N2O7Si — CID 10995850
1-[(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10995850) has the molecular formula C36H44N2O7Si and a molecular weight of 644.84 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10995850 |
| Molecular Formula | C36H44N2O7Si |
| Molecular Weight | 644.84 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2CO)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H44N2O7Si/c1-35(2,3)46(5,6)45-32-29(23-39)30(44-33(32)38-22-21-31(40)37-34(38)41)24-43-36(25-13-9-7-10-14-25,26-15-11-8-12-16-26)27-17-19-28(42-4)20-18-27/h7-22,29-30,32-33,39H,23-24H2,1-6H3,(H,37,40,41)/t29-,30+,32+,33+/m0/s1 |
| InChIKey | ZNWRLTBEJCTNQZ-GITOVDKFSA-N |
| XLogP | 5.45 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|