C37H47N3O8Si — CID 10652222
1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxyamino)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10652222) has the molecular formula C37H47N3O8Si and a molecular weight of 689.88 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxyamino)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxyamino)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10652222 |
| Molecular Formula | C37H47N3O8Si |
| Molecular Weight | 689.88 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxyamino)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CON[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C37H47N3O8Si/c1-36(2,3)49(7,8)48-33-30(47-34(32(33)39-45-6)40-23-22-31(41)38-35(40)42)24-46-37(25-12-10-9-11-13-25,26-14-18-28(43-4)19-15-26)27-16-20-29(44-5)21-17-27/h9-23,30,32-34,39H,24H2,1-8H3,(H,38,41,42)/t30-,32-,33-,34-/m1/s1 |
| InChIKey | SIQABYWEUYRNJK-DWNQJFHRSA-N |
| XLogP | 5.37 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|