C34H41N2O8PSi — CID 71623391
[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] dihydrogen phosphite (PubChem CID 71623391) has the molecular formula C34H41N2O8PSi and a molecular weight of 664.77 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] dihydrogen phosphite.
| Compound Name | [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] dihydrogen phosphite |
|---|---|
| PubChem CID | 71623391 |
| Molecular Formula | C34H41N2O8PSi |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(trityloxymethyl)oxolan-3-yl] dihydrogen phosphite |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OP(O)O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C34H41N2O8PSi/c1-33(2,3)46(4,5)44-30-29(43-45(39)40)27(42-31(30)36-22-21-28(37)35-32(36)38)23-41-34(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-22,27,29-31,39-40H,23H2,1-5H3,(H,35,37,38)/t27-,29-,30-,31-/m1/s1 |
| InChIKey | XALNKRQTLASLMY-PMFUCWTESA-N |
| XLogP | 5.43 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|