C48H42N2O8S — CID 99653129
[(2R,3S,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 99653129) has the molecular formula C48H42N2O8S and a molecular weight of 806.94 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 99653129 |
| Molecular Formula | C48H42N2O8S |
| Molecular Weight | 806.94 g/mol |
| Exact Mass | 806.27 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-4-trityloxy-2-(trityloxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H42N2O8S/c1-59(53,54)58-43-41(34-55-47(35-20-8-2-9-21-35,36-22-10-3-11-23-36)37-24-12-4-13-25-37)56-45(50-33-32-42(51)49-46(50)52)44(43)57-48(38-26-14-5-15-27-38,39-28-16-6-17-29-39)40-30-18-7-19-31-40/h2-33,41,43-45H,34H2,1H3,(H,49,51,52)/t41-,43+,44-,45+/m1/s1 |
| InChIKey | CILSTBQZISAPNO-ULHREGHNSA-N |
| XLogP | 7.16 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.94 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|