C22H42N2O8SSi2 — CID 174108053
[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate (PubChem CID 174108053) has the molecular formula C22H42N2O8SSi2 and a molecular weight of 550.82 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 174108053 |
| Molecular Formula | C22H42N2O8SSi2 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C22H42N2O8SSi2/c1-21(2,3)34(8,9)29-14-15-17(31-33(7,27)28)18(32-35(10,11)22(4,5)6)19(30-15)24-13-12-16(25)23-20(24)26/h12-13,15,17-19H,14H2,1-11H3,(H,23,25,26)/t15-,17-,18-,19-/m1/s1 |
| InChIKey | SLUWRPZNIQYCEE-NXWXRZEISA-N |
| XLogP | 3.19 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|