C23H42N2O7Si2 — CID 57337248
1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 57337248) has the molecular formula C23H42N2O7Si2 and a molecular weight of 514.77 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57337248 |
| Molecular Formula | C23H42N2O7Si2 |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]([C@@H]2O[C@H]2CO)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42N2O7Si2/c1-22(2,3)33(7,8)31-18-17(16-14(13-26)29-16)30-20(25-12-11-15(27)24-21(25)28)19(18)32-34(9,10)23(4,5)6/h11-12,14,16-20,26H,13H2,1-10H3,(H,24,27,28)/t14-,16+,17+,18+,19+,20+/m0/s1 |
| InChIKey | BZIMXHMHQVDNMU-WBUMTXOPSA-N |
| XLogP | 2.97 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|