C21H40N2O8PSi2+ — CID 101203363
[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 101203363) has the molecular formula C21H40N2O8PSi2+ and a molecular weight of 535.70 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 101203363 |
| Molecular Formula | C21H40N2O8PSi2+ |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[P+](=O)O |
| InChI | InChI=1S/C21H39N2O8PSi2/c1-20(2,3)33(7,8)28-13-14-16(30-32(26)27)17(31-34(9,10)21(4,5)6)18(29-14)23-12-11-15(24)22-19(23)25/h11-12,14,16-18H,13H2,1-10H3,(H-,22,24,25,26,27)/p+1/t14-,16-,17-,18-/m1/s1 |
| InChIKey | ZHKVGJRBLLIOCV-VDHUWJSZSA-O |
| XLogP | 3.88 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|