C21H40N2O5Si2 — CID 57102324
1-[(2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 57102324) has the molecular formula C21H40N2O5Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is 1-[(2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57102324 |
| Molecular Formula | C21H40N2O5Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-[(2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC(O[Si](C)(C)C(C)(C)C)[C@@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C21H40N2O5Si2/c1-20(2,3)29(7,8)26-14-15-13-16(28-30(9,10)21(4,5)6)18(27-15)23-12-11-17(24)22-19(23)25/h11-12,15-16,18H,13-14H2,1-10H3,(H,22,24,25)/t15-,16?,18+/m1/s1 |
| InChIKey | BSHVXSKECYXCPB-AGPBCMBSSA-N |
| XLogP | 4.24 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|