C14H24N2O4SSi — CID 20744743
1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione (PubChem CID 20744743) has the molecular formula C14H24N2O4SSi and a molecular weight of 344.51 g/mol. Its IUPAC name is 1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20744743 |
| Molecular Formula | C14H24N2O4SSi |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(=O)[nH]c2=O)CS1 |
| InChI | InChI=1S/C14H24N2O4SSi/c1-14(2,3)22(4,5)19-8-12-20-11(9-21-12)16-7-6-10(17)15-13(16)18/h6-7,11-12H,8-9H2,1-5H3,(H,15,17,18) |
| InChIKey | LCOBQLLOWNCCFD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|