C9H12N2O3S — CID 58813307
1-(2-ethyl-1,3-oxathiolan-5-yl)pyrimidine-2,4-dione (PubChem CID 58813307) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-oxathiolan-5-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-ethyl-1,3-oxathiolan-5-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58813307 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(2-ethyl-1,3-oxathiolan-5-yl)pyrimidine-2,4-dione |
| SMILES | CCC1OC(n2ccc(=O)[nH]c2=O)CS1 |
| InChI | InChI=1S/C9H12N2O3S/c1-2-8-14-7(5-15-8)11-4-3-6(12)10-9(11)13/h3-4,7-8H,2,5H2,1H3,(H,10,12,13) |
| InChIKey | RIFRHXGVPAJBPJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |