C9H11ClN2O3 — CID 23261037
1-[(2R,5S)-5-(chloromethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 23261037) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(chloromethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-(chloromethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23261037 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1-[(2R,5S)-5-(chloromethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2CC[C@@H](CCl)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H11ClN2O3/c10-5-6-1-2-8(15-6)12-4-3-7(13)11-9(12)14/h3-4,6,8H,1-2,5H2,(H,11,13,14)/t6-,8+/m0/s1 |
| InChIKey | PBSLVBJLHDDPPY-POYBYMJQSA-N |
| XLogP | 0.45 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|