C10H15N3O3 — CID 170586971
1-[5-(methylaminomethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 170586971) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-[5-(methylaminomethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-(methylaminomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170586971 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-[5-(methylaminomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CNCC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H15N3O3/c1-11-6-7-2-3-9(16-7)13-5-4-8(14)12-10(13)15/h4-5,7,9,11H,2-3,6H2,1H3,(H,12,14,15) |
| InChIKey | KPGGDOVYLFJCGQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |