C10H14N2O5 — CID 169252397
5-(2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde;methanol (PubChem CID 169252397) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 5-(2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde;methanol.
| Compound Name | 5-(2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde;methanol |
|---|---|
| PubChem CID | 169252397 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 5-(2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde;methanol |
| SMILES | CO.O=CC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H10N2O4.CH4O/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14;1-2/h3-6,8H,1-2H2,(H,10,13,14);2H,1H3 |
| InChIKey | YVSGVJVZRKPYQZ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|