C14H26N2O6 — CID 163227427
ethane;1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;propane-2,2-diol (PubChem CID 163227427) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethane;1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;propane-2,2-diol.
| Compound Name | ethane;1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;propane-2,2-diol |
|---|---|
| PubChem CID | 163227427 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | ethane;1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.O=c1ccn(C2CC[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O4.C3H8O2.C2H6/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14;1-3(2,4)5;1-2/h3-4,6,8,12H,1-2,5H2,(H,10,13,14);4-5H,1-2H3;1-2H3/t6-,8?;;/m0../s1 |
| InChIKey | RPVJBQRULQLWGO-LSXYXRMLSA-N |
| XLogP | -0.06 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|