C8H10N2O4 — CID 57243350
1-[(2R,4S)-4-(hydroxymethyl)oxetan-2-yl]pyrimidine-2,4-dione (PubChem CID 57243350) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 1-[(2R,4S)-4-(hydroxymethyl)oxetan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-4-(hydroxymethyl)oxetan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57243350 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-[(2R,4S)-4-(hydroxymethyl)oxetan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2C[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H10N2O4/c11-4-5-3-7(14-5)10-2-1-6(12)9-8(10)13/h1-2,5,7,11H,3-4H2,(H,9,12,13)/t5-,7+/m0/s1 |
| InChIKey | YFVPLXSSZYMFND-CAHLUQPWSA-N |
| XLogP | -1.18 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |