C10H16N2O5 — CID 178082525
1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol (PubChem CID 178082525) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol.
| Compound Name | 1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol |
|---|---|
| PubChem CID | 178082525 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-[(5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;methanol |
| SMILES | CO.O=c1ccn(C2CC[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O4.CH4O/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14;1-2/h3-4,6,8,12H,1-2,5H2,(H,10,13,14);2H,1H3/t6-,8?;/m0./s1 |
| InChIKey | GRKLOJQGEBLFQK-IHEARLNSSA-N |
| XLogP | -1.18 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |