C11H18N2O5 — CID 145071309
methanol;1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 145071309) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is methanol;1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | methanol;1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145071309 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | methanol;1-[(2R,5S)-5-(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CO.COC[C@@H]1CC[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H14N2O4.CH4O/c1-15-6-7-2-3-9(16-7)12-5-4-8(13)11-10(12)14;1-2/h4-5,7,9H,2-3,6H2,1H3,(H,11,13,14);2H,1H3/t7-,9+;/m0./s1 |
| InChIKey | VYUGGJOLARLPBG-DKXTVVGFSA-N |
| XLogP | -0.53 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |