C18H20N2O6 — CID 166712934
[4-[[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl]phenyl] acetate (PubChem CID 166712934) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is [4-[[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl]phenyl] acetate.
| Compound Name | [4-[[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 166712934 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [4-[[(2S,5R)-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COC[C@@H]2CC[C@H](n3ccc(=O)[nH]c3=O)O2)cc1 |
| InChI | InChI=1S/C18H20N2O6/c1-12(21)25-14-4-2-13(3-5-14)10-24-11-15-6-7-17(26-15)20-9-8-16(22)19-18(20)23/h2-5,8-9,15,17H,6-7,10-11H2,1H3,(H,19,22,23)/t15-,17+/m0/s1 |
| InChIKey | FYGMULLBPZFULJ-DOTOQJQBSA-N |
| XLogP | 1.36 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|