C20H26N3O7P — CID 144948853
benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]amino]propanoate (PubChem CID 144948853) has the molecular formula C20H26N3O7P and a molecular weight of 451.42 g/mol. Its IUPAC name is benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]amino]propanoate.
| Compound Name | benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144948853 |
| Molecular Formula | C20H26N3O7P |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | benzyl 2-[[[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]amino]propanoate |
| SMILES | COP(NC(C)C(=O)OCc1ccccc1)OCC1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C20H26N3O7P/c1-14(19(25)28-12-15-6-4-3-5-7-15)22-31(27-2)29-13-16-8-9-18(30-16)23-11-10-17(24)21-20(23)26/h3-7,10-11,14,16,18,22H,8-9,12-13H2,1-2H3,(H,21,24,26) |
| InChIKey | IBUHVJAPYPANSW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|