C29H37N2O8P — CID 171528895
benzyl [2-[(3,4-dimethylphenyl)methoxy]-3-methoxypropyl] [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphite (PubChem CID 171528895) has the molecular formula C29H37N2O8P and a molecular weight of 572.60 g/mol. Its IUPAC name is benzyl [2-[(3,4-dimethylphenyl)methoxy]-3-methoxypropyl] [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphite.
| Compound Name | benzyl [2-[(3,4-dimethylphenyl)methoxy]-3-methoxypropyl] [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphite |
|---|---|
| PubChem CID | 171528895 |
| Molecular Formula | C29H37N2O8P |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | benzyl [2-[(3,4-dimethylphenyl)methoxy]-3-methoxypropyl] [5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphite |
| SMILES | COCC(COP(OCc1ccccc1)OCC1CCC(n2ccc(=O)[nH]c2=O)O1)OCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C29H37N2O8P/c1-21-9-10-24(15-22(21)2)16-35-26(18-34-3)20-38-40(36-17-23-7-5-4-6-8-23)37-19-25-11-12-28(39-25)31-14-13-27(32)30-29(31)33/h4-10,13-15,25-26,28H,11-12,16-20H2,1-3H3,(H,30,32,33) |
| InChIKey | NLZNOTZGZGAZTK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|