C19H23N2O6P — CID 172580678
1-[5-[(6,7,8-trimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 172580678) has the molecular formula C19H23N2O6P and a molecular weight of 406.38 g/mol. Its IUPAC name is 1-[5-[(6,7,8-trimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[(6,7,8-trimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172580678 |
| Molecular Formula | C19H23N2O6P |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1-[5-[(6,7,8-trimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cc2c(c(C)c1C)OP(OCC1CCC(n3ccc(=O)[nH]c3=O)O1)OC2 |
| InChI | InChI=1S/C19H23N2O6P/c1-11-8-14-9-24-28(27-18(14)13(3)12(11)2)25-10-15-4-5-17(26-15)21-7-6-16(22)20-19(21)23/h6-8,15,17H,4-5,9-10H2,1-3H3,(H,20,22,23) |
| InChIKey | UVRYDJFZVODNGC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|