C17H19F2N2O6P — CID 164882016
1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione;fluoromethane (PubChem CID 164882016) has the molecular formula C17H19F2N2O6P and a molecular weight of 416.32 g/mol. Its IUPAC name is 1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione;fluoromethane.
| Compound Name | 1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione;fluoromethane |
|---|---|
| PubChem CID | 164882016 |
| Molecular Formula | C17H19F2N2O6P |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione;fluoromethane |
| SMILES | CF.O=c1[nH]c(=O)n(C2CCC(COP3OCc4ccccc4O3)O2)cc1F |
| InChI | InChI=1S/C16H16FN2O6P.CH3F/c17-12-7-19(16(21)18-15(12)20)14-6-5-11(24-14)9-23-26-22-8-10-3-1-2-4-13(10)25-26;1-2/h1-4,7,11,14H,5-6,8-9H2,(H,18,20,21);1H3 |
| InChIKey | WMPVDHIZMWJBCF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|