C16H15ClFN2O6P — CID 171529077
1-[5-[(6-chloro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 171529077) has the molecular formula C16H15ClFN2O6P and a molecular weight of 416.73 g/mol. Its IUPAC name is 1-[5-[(6-chloro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[5-[(6-chloro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171529077 |
| Molecular Formula | C16H15ClFN2O6P |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 1-[5-[(6-chloro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C2CCC(COP3OCc4cc(Cl)ccc4O3)O2)cc1F |
| InChI | InChI=1S/C16H15ClFN2O6P/c17-10-1-3-13-9(5-10)7-23-27(26-13)24-8-11-2-4-14(25-11)20-6-12(18)15(21)19-16(20)22/h1,3,5-6,11,14H,2,4,7-8H2,(H,19,21,22) |
| InChIKey | NMOQCGFPACEKCQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|