C16H17N2O5PS — CID 156804197
1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 156804197) has the molecular formula C16H17N2O5PS and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 156804197 |
| Molecular Formula | C16H17N2O5PS |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)ccn1C1CCC(COP2OCc3ccccc3O2)O1 |
| InChI | InChI=1S/C16H17N2O5PS/c19-16-17-14(25)7-8-18(16)15-6-5-12(22-15)10-21-24-20-9-11-3-1-2-4-13(11)23-24/h1-4,7-8,12,15H,5-6,9-10H2,(H,17,19,25) |
| InChIKey | QCEOHSIBHVYBKP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|