C16H18N2O6PS+ — CID 153342383
1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 153342383) has the molecular formula C16H18N2O6PS+ and a molecular weight of 397.37 g/mol. Its IUPAC name is 1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 153342383 |
| Molecular Formula | C16H18N2O6PS+ |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)ccn1C1CCC(CO[P+]2(O)OCc3ccccc3O2)O1 |
| InChI | InChI=1S/C16H17N2O6PS/c19-16-17-14(26)7-8-18(16)15-6-5-12(23-15)10-22-25(20)21-9-11-3-1-2-4-13(11)24-25/h1-4,7-8,12,15,20H,5-6,9-10H2/p+1 |
| InChIKey | VGFHGMVZHDGKPT-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|