C17H19B2FN2O6PS+ — CID 153341880
CID 153341880 (PubChem CID 153341880) has the molecular formula C17H19B2FN2O6PS+ and a molecular weight of 451.01 g/mol.
| Compound Name | CID 153341880 |
|---|---|
| PubChem CID | 153341880 |
| Molecular Formula | C17H19B2FN2O6PS+ |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | — |
| SMILES | [B]CO[P+]1(O)OCc2cccc(C)c2O1.[B][C@@H]1CCC(n2cc(F)c(=S)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H11BO4P.C8H8BFN2O2S/c1-7-3-2-4-8-5-12-15(11,13-6-10)14-9(7)8;9-5-1-2-6(14-5)12-3-4(10)7(15)11-8(12)13/h2-4,11H,5-6H2,1H3;3,5-6H,1-2H2,(H,11,13,15)/q+1;/t;5-,6?/m.0/s1 |
| InChIKey | GESPYDFSOGMKNF-CUUSOBIJSA-N |
| XLogP | 2.57 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|