C18H21N2O7PS — CID 171528639
1-[5-[dihydroxy-[(8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one (PubChem CID 171528639) has the molecular formula C18H21N2O7PS and a molecular weight of 440.41 g/mol. Its IUPAC name is 1-[5-[dihydroxy-[(8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[5-[dihydroxy-[(8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 171528639 |
| Molecular Formula | C18H21N2O7PS |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-[5-[dihydroxy-[(8-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
| SMILES | Cc1cccc2c1OP(OC(O)(O)C1CCC(n3cc(C)c(=S)[nH]c3=O)O1)OC2 |
| InChI | InChI=1S/C18H21N2O7PS/c1-10-4-3-5-12-9-24-28(26-15(10)12)27-18(22,23)13-6-7-14(25-13)20-8-11(2)16(29)19-17(20)21/h3-5,8,13-14,22-23H,6-7,9H2,1-2H3,(H,19,21,29) |
| InChIKey | HGFQJUKDNRZISO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|