C19H18BN2O7P — CID 171529014
CID 171529014 (PubChem CID 171529014) has the molecular formula C19H18BN2O7P and a molecular weight of 428.15 g/mol.
| Compound Name | CID 171529014 |
|---|---|
| PubChem CID | 171529014 |
| Molecular Formula | C19H18BN2O7P |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | — |
| SMILES | [B][C@](O)(OP1OCc2cccc(C)c2O1)C1CCC(n2cc(C#C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C19H18BN2O7P/c1-3-12-9-22(18(24)21-17(12)23)15-8-7-14(27-15)19(20,25)29-30-26-10-13-6-4-5-11(2)16(13)28-30/h1,4-6,9,14-15,25H,7-8,10H2,2H3,(H,21,23,24)/t14?,15?,19-,30?/m1/s1 |
| InChIKey | IZEWUJUVWRRRFG-JNWTXNCOSA-N |
| XLogP | 1.17 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|