C16H23N3O7 — CID 171528611
[[5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-dihydroxymethyl] 2-aminoacetate;propane (PubChem CID 171528611) has the molecular formula C16H23N3O7 and a molecular weight of 369.37 g/mol. Its IUPAC name is [[5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-dihydroxymethyl] 2-aminoacetate;propane.
| Compound Name | [[5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-dihydroxymethyl] 2-aminoacetate;propane |
|---|---|
| PubChem CID | 171528611 |
| Molecular Formula | C16H23N3O7 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [[5-(5-ethynyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-dihydroxymethyl] 2-aminoacetate;propane |
| SMILES | C#Cc1cn(C2CCC(C(O)(O)OC(=O)CN)O2)c(=O)[nH]c1=O.CCC |
| InChI | InChI=1S/C13H15N3O7.C3H8/c1-2-7-6-16(12(19)15-11(7)18)9-4-3-8(22-9)13(20,21)23-10(17)5-14;1-3-2/h1,6,8-9,20-21H,3-5,14H2,(H,15,18,19);3H2,1-2H3 |
| InChIKey | YOKJWDLIVWRWAN-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|