C10H13B2FN2O5 — CID 156804470
CID 156804470 (PubChem CID 156804470) has the molecular formula C10H13B2FN2O5 and a molecular weight of 281.85 g/mol.
| Compound Name | CID 156804470 |
|---|---|
| PubChem CID | 156804470 |
| Molecular Formula | C10H13B2FN2O5 |
| Molecular Weight | 281.85 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | — |
| SMILES | CO.[B]C([B])(O)C1CCC(n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H9B2FN2O4.CH4O/c10-9(11,17)5-1-2-6(18-5)14-3-4(12)7(15)13-8(14)16;1-2/h3,5-6,17H,1-2H2,(H,13,15,16);2H,1H3 |
| InChIKey | TWUGBRZYAJKVFN-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.85 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|