C12H18FN2O6P — CID 139341090
[5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propyl hydrogen phosphite (PubChem CID 139341090) has the molecular formula C12H18FN2O6P and a molecular weight of 336.26 g/mol. Its IUPAC name is [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propyl hydrogen phosphite.
| Compound Name | [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propyl hydrogen phosphite |
|---|---|
| PubChem CID | 139341090 |
| Molecular Formula | C12H18FN2O6P |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl propyl hydrogen phosphite |
| SMILES | CCCOP(O)OCC1CCC(n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C12H18FN2O6P/c1-2-5-19-22(18)20-7-8-3-4-10(21-8)15-6-9(13)11(16)14-12(15)17/h6,8,10,18H,2-5,7H2,1H3,(H,14,16,17) |
| InChIKey | KFUGSIXVBYLNEQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|