C18H22FN2O7P — CID 142624421
(3,5-dimethylphenyl)methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 142624421) has the molecular formula C18H22FN2O7P and a molecular weight of 428.35 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | (3,5-dimethylphenyl)methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 142624421 |
| Molecular Formula | C18H22FN2O7P |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (3,5-dimethylphenyl)methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Cc1cc(C)cc(COP(=O)(O)OC[C@@H]2CC[C@H](n3cc(F)c(=O)[nH]c3=O)O2)c1 |
| InChI | InChI=1S/C18H22FN2O7P/c1-11-5-12(2)7-13(6-11)9-26-29(24,25)27-10-14-3-4-16(28-14)21-8-15(19)17(22)20-18(21)23/h5-8,14,16H,3-4,9-10H2,1-2H3,(H,24,25)(H,20,22,23)/t14-,16+/m0/s1 |
| InChIKey | ZIXZOWSHSNXUFI-GOEBONIOSA-N |
| XLogP | 2.30 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|