C16H15F4N2O7P — CID 142624414
[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2,4,5-trifluorophenyl)methyl hydrogen phosphate (PubChem CID 142624414) has the molecular formula C16H15F4N2O7P and a molecular weight of 454.27 g/mol. Its IUPAC name is [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2,4,5-trifluorophenyl)methyl hydrogen phosphate.
| Compound Name | [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2,4,5-trifluorophenyl)methyl hydrogen phosphate |
|---|---|
| PubChem CID | 142624414 |
| Molecular Formula | C16H15F4N2O7P |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2,4,5-trifluorophenyl)methyl hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC[C@@H](COP(=O)(O)OCc3cc(F)c(F)cc3F)O2)cc1F |
| InChI | InChI=1S/C16H15F4N2O7P/c17-10-4-12(19)11(18)3-8(10)6-27-30(25,26)28-7-9-1-2-14(29-9)22-5-13(20)15(23)21-16(22)24/h3-5,9,14H,1-2,6-7H2,(H,25,26)(H,21,23,24)/t9-,14+/m0/s1 |
| InChIKey | CURSFCPGOLKNNJ-LKFCYVNXSA-N |
| XLogP | 2.10 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|