C19H23FN7O9PS — CID 174316819
[(2R,3R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 174316819) has the molecular formula C19H23FN7O9PS and a molecular weight of 575.47 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 174316819 |
| Molecular Formula | C19H23FN7O9PS |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | [(2R,3R,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc(=S)c2ncn([C@H]3C[C@@H](O)[C@@H](COP(=O)(O)OC[C@@H]4CC[C@H](n5cc(F)c(=O)[nH]c5=O)O4)O3)c2[nH]1 |
| InChI | InChI=1S/C19H23FN7O9PS/c20-9-4-26(19(30)24-16(9)29)12-2-1-8(35-12)5-33-37(31,32)34-6-11-10(28)3-13(36-11)27-7-22-14-15(27)23-18(21)25-17(14)38/h4,7-8,10-13,28H,1-3,5-6H2,(H,31,32)(H,24,29,30)(H3,21,23,25,38)/t8-,10+,11+,12+,13+/m0/s1 |
| InChIKey | DKVUFFJKIIPTOT-VECUTGAWSA-N |
| XLogP | 0.22 |
| TPSA | 221.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|