C14H20N5O5PS3 — CID 155033692
[(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl [(4S)-dithian-4-yl] hydrogen phosphate (PubChem CID 155033692) has the molecular formula C14H20N5O5PS3 and a molecular weight of 465.52 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl [(4S)-dithian-4-yl] hydrogen phosphate.
| Compound Name | [(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl [(4S)-dithian-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 155033692 |
| Molecular Formula | C14H20N5O5PS3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | [(2S,5R)-5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methyl [(4S)-dithian-4-yl] hydrogen phosphate |
| SMILES | Nc1nc(=S)c2ncn([C@H]3CC[C@@H](COP(=O)(O)O[C@H]4CCSSC4)O3)c2[nH]1 |
| InChI | InChI=1S/C14H20N5O5PS3/c15-14-17-12-11(13(26)18-14)16-7-19(12)10-2-1-8(23-10)5-22-25(20,21)24-9-3-4-27-28-6-9/h7-10H,1-6H2,(H,20,21)(H3,15,17,18,26)/t8-,9-,10+/m0/s1 |
| InChIKey | MJXXPLCZDBHIDX-LPEHRKFASA-N |
| XLogP | 3.04 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|