C22H35N5O9PS+ — CID 164882265
[5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium (PubChem CID 164882265) has the molecular formula C22H35N5O9PS+ and a molecular weight of 576.59 g/mol. Its IUPAC name is [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium.
| Compound Name | [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium |
|---|---|
| PubChem CID | 164882265 |
| Molecular Formula | C22H35N5O9PS+ |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | [5-(2-amino-6-sulfanylidene-3H-purin-9-yl)oxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium |
| SMILES | CC(C)(C)C(=O)OCO[P+](O)(OCOC(=O)C(C)(C)C)OCC1CCC(n2cnc3c(=S)nc(N)[nH]c32)O1 |
| InChI | InChI=1S/C22H34N5O9PS/c1-21(2,3)18(28)31-11-34-37(30,35-12-32-19(29)22(4,5)6)33-9-13-7-8-14(36-13)27-10-24-15-16(27)25-20(23)26-17(15)38/h10,13-14,30H,7-9,11-12H2,1-6H3,(H2-,23,25,26,38)/p+1 |
| InChIKey | PWNUAOPSXBRBMF-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 182.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|