C25H37N5O10P+ — CID 164882129
[5-(2-amino-6-methoxypurin-9-yl)-5-ethynyloxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium (PubChem CID 164882129) has the molecular formula C25H37N5O10P+ and a molecular weight of 598.57 g/mol. Its IUPAC name is [5-(2-amino-6-methoxypurin-9-yl)-5-ethynyloxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium.
| Compound Name | [5-(2-amino-6-methoxypurin-9-yl)-5-ethynyloxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium |
|---|---|
| PubChem CID | 164882129 |
| Molecular Formula | C25H37N5O10P+ |
| Molecular Weight | 598.57 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | [5-(2-amino-6-methoxypurin-9-yl)-5-ethynyloxolan-2-yl]methoxy-bis(2,2-dimethylpropanoyloxymethoxy)-hydroxyphosphanium |
| SMILES | C#CC1(n2cnc3c(OC)nc(N)nc32)CCC(CO[P+](O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H37N5O10P/c1-9-25(30-13-27-17-18(30)28-22(26)29-19(17)34-8)11-10-16(40-25)12-37-41(33,38-14-35-20(31)23(2,3)4)39-15-36-21(32)24(5,6)7/h1,13,16,33H,10-12,14-15H2,2-8H3,(H2,26,28,29)/q+1 |
| InChIKey | SVMUBWCQKUXRCH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 188.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|