C17H25N5O4 — CID 164882383
[(5R)-5-(2-amino-6-ethoxypurin-9-yl)-5-methyloxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 164882383) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is [(5R)-5-(2-amino-6-ethoxypurin-9-yl)-5-methyloxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(5R)-5-(2-amino-6-ethoxypurin-9-yl)-5-methyloxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 164882383 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [(5R)-5-(2-amino-6-ethoxypurin-9-yl)-5-methyloxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@]1(C)CCC(COC(=O)C(C)C)O1 |
| InChI | InChI=1S/C17H25N5O4/c1-5-24-14-12-13(20-16(18)21-14)22(9-19-12)17(4)7-6-11(26-17)8-25-15(23)10(2)3/h9-11H,5-8H2,1-4H3,(H2,18,20,21)/t11?,17-/m1/s1 |
| InChIKey | MMUOUQVTUKWILP-DFDFJRDNSA-N |
| XLogP | 1.86 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |