C22H34ClN6O7P — CID 118966225
[(2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutyl] 2-methylpropanoate (PubChem CID 118966225) has the molecular formula C22H34ClN6O7P and a molecular weight of 560.98 g/mol. Its IUPAC name is [(2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutyl] 2-methylpropanoate.
| Compound Name | [(2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 118966225 |
| Molecular Formula | C22H34ClN6O7P |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [(2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-chloro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]-3-methylbutyl] 2-methylpropanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)(N[C@H](COC(=O)C(C)C)C(C)C)O[C@H]2[C@@]1(C)Cl |
| InChI | InChI=1S/C22H34ClN6O7P/c1-7-32-18-15-17(26-21(24)27-18)29(10-25-15)20-22(6,23)16-14(35-20)9-34-37(31,36-16)28-13(11(2)3)8-33-19(30)12(4)5/h10-14,16,20H,7-9H2,1-6H3,(H,28,31)(H2,24,26,27)/t13-,14-,16-,20-,22-,37-/m1/s1 |
| InChIKey | HNWSTUZSSNBICQ-MYGFQOMDSA-N |
| XLogP | 3.04 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|