C17H24FN6O7P — CID 90284789
methyl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 90284789) has the molecular formula C17H24FN6O7P and a molecular weight of 474.39 g/mol. Its IUPAC name is methyl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | methyl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 90284789 |
| Molecular Formula | C17H24FN6O7P |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | methyl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(NC(C)C(=O)OC)O[C@H]2[C@@]1(C)F |
| InChI | InChI=1S/C17H24FN6O7P/c1-5-28-13-10-12(21-16(19)22-13)24(7-20-10)15-17(3,18)11-9(30-15)6-29-32(26,31-11)23-8(2)14(25)27-4/h7-9,11,15H,5-6H2,1-4H3,(H,23,26)(H2,19,21,22)/t8?,9-,11-,15-,17-,32?/m1/s1 |
| InChIKey | ZSIMJKFAUFTNNM-RQZCHJCMSA-N |
| XLogP | 1.11 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|