C17H24FN6O6P — CID 118311532
propan-2-yl (2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-aminopurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 118311532) has the molecular formula C17H24FN6O6P and a molecular weight of 458.39 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-aminopurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-aminopurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 118311532 |
| Molecular Formula | C17H24FN6O6P |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2R,4aR,6R,7R,7aR)-6-(2-aminopurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@@]1(=O)OC[C@H]2O[C@@H](n3cnc4cnc(N)nc43)[C@](C)(F)[C@@H]2O1 |
| InChI | InChI=1S/C17H24FN6O6P/c1-8(2)28-14(25)9(3)23-31(26)27-6-11-12(30-31)17(4,18)15(29-11)24-7-21-10-5-20-16(19)22-13(10)24/h5,7-9,11-12,15H,6H2,1-4H3,(H,23,26)(H2,19,20,22)/t9-,11+,12+,15+,17+,31+/m0/s1 |
| InChIKey | DJWMOHCAPLWWMS-BCPXXBCZSA-N |
| XLogP | 1.49 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|