C19H25FN7O6P — CID 139294653
propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(methylamino)purin-9-yl]-7-ethynyl-7-fluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 139294653) has the molecular formula C19H25FN7O6P and a molecular weight of 497.42 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(methylamino)purin-9-yl]-7-ethynyl-7-fluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(methylamino)purin-9-yl]-7-ethynyl-7-fluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 139294653 |
| Molecular Formula | C19H25FN7O6P |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | propan-2-yl (2S)-2-[[(4aR,6R,7R,7aR)-6-[2-amino-6-(methylamino)purin-9-yl]-7-ethynyl-7-fluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | C#C[C@@]1(F)[C@@H]2OP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@H]2O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C19H25FN7O6P/c1-6-19(20)13-11(7-30-34(29,33-13)26-10(4)16(28)31-9(2)3)32-17(19)27-8-23-12-14(22-5)24-18(21)25-15(12)27/h1,8-11,13,17H,7H2,2-5H3,(H,26,29)(H3,21,22,24,25)/t10-,11+,13+,17+,19+,34?/m0/s1 |
| InChIKey | ZLRPCADFUYIGLG-OYZAERLKSA-N |
| XLogP | 1.14 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|