C13H14FN6O6P — CID 139293778
[(1R,3R,4R,5S)-3-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate (PubChem CID 139293778) has the molecular formula C13H14FN6O6P and a molecular weight of 400.26 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-3-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate.
| Compound Name | [(1R,3R,4R,5S)-3-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 139293778 |
| Molecular Formula | C13H14FN6O6P |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | [(1R,3R,4R,5S)-3-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] dihydrogen phosphate |
| SMILES | C#C[C@]1(F)[C@H](n2cnc3c(NC)nc(N)nc32)O[C@@H]2C(OP(=O)(O)O)[C@@]21O |
| InChI | InChI=1S/C13H14FN6O6P/c1-3-12(14)10(25-6-7(13(6,12)21)26-27(22,23)24)20-4-17-5-8(16-2)18-11(15)19-9(5)20/h1,4,6-7,10,21H,2H3,(H2,22,23,24)(H3,15,16,18,19)/t6-,7?,10-,12+,13+/m1/s1 |
| InChIKey | BTZSINCDHWUNBU-RVJKWZOGSA-N |
| XLogP | -1.09 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|