C12H20N6O10P2 — CID 139293637
[(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 139293637) has the molecular formula C12H20N6O10P2 and a molecular weight of 470.27 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 139293637 |
| Molecular Formula | C12H20N6O10P2 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C12H20N6O10P2/c1-12(20)7(19)5(3-26-30(24,25)28-29(21,22)23)27-10(12)18-4-15-6-8(14-2)16-11(13)17-9(6)18/h4-5,7,10,19-20H,3H2,1-2H3,(H,24,25)(H2,21,22,23)(H3,13,14,16,17)/t5-,7-,10-,12-/m1/s1 |
| InChIKey | LGZILNSCRIFHDU-GSWPYSDESA-N |
| XLogP | -1.31 |
| TPSA | 244.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|